C18H27N3O3 — CID 99643155
1-cycloheptyl-1-methyl-3-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]urea (PubChem CID 99643155) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-cycloheptyl-1-methyl-3-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]urea.
| Compound Name | 1-cycloheptyl-1-methyl-3-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]urea |
|---|---|
| PubChem CID | 99643155 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 1-cycloheptyl-1-methyl-3-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]urea |
| SMILES | CN(C(=O)Nc1ccnc(O[C@H]2CCOC2)c1)C1CCCCCC1 |
| InChI | InChI=1S/C18H27N3O3/c1-21(15-6-4-2-3-5-7-15)18(22)20-14-8-10-19-17(12-14)24-16-9-11-23-13-16/h8,10,12,15-16H,2-7,9,11,13H2,1H3,(H,19,20,22)/t16-/m0/s1 |
| InChIKey | UXVKYTDIWYCHHT-INIZCTEOSA-N |
| XLogP | 3.44 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |