C15H18N2O3 — CID 97250433
(2E,4E)-N-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]hexa-2,4-dienamide (PubChem CID 97250433) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is (2E,4E)-N-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 97250433 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | (2E,4E)-N-[2-[(3S)-oxolan-3-yl]oxy-4-pyridinyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1ccnc(O[C@H]2CCOC2)c1 |
| InChI | InChI=1S/C15H18N2O3/c1-2-3-4-5-14(18)17-12-6-8-16-15(10-12)20-13-7-9-19-11-13/h2-6,8,10,13H,7,9,11H2,1H3,(H,16,17,18)/b3-2+,5-4+/t13-/m0/s1 |
| InChIKey | HKKZQBGQCOYCMH-VGOFJFCRSA-N |
| XLogP | 2.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|