C10H11NO4 — CID 63559237
2-(oxolan-3-yloxy)pyridine-4-carboxylic acid (PubChem CID 63559237) has the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. Its IUPAC name is 2-(oxolan-3-yloxy)pyridine-4-carboxylic acid.
| Compound Name | 2-(oxolan-3-yloxy)pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 63559237 |
| Molecular Formula | C10H11NO4 |
| Molecular Weight | 209.20 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(oxolan-3-yloxy)pyridine-4-carboxylic acid |
| SMILES | O=C(O)c1ccnc(OC2CCOC2)c1 |
| InChI | InChI=1S/C10H11NO4/c12-10(13)7-1-3-11-9(5-7)15-8-2-4-14-6-8/h1,3,5,8H,2,4,6H2,(H,12,13) |
| InChIKey | YCDWONJBBVJNSS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |