C13H16N2O5 — CID 120525990
(2S)-2-[[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]propanoic acid (PubChem CID 120525990) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is (2S)-2-[[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 120525990 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2S)-2-[[2-(oxolan-3-yloxy)pyridine-4-carbonyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccnc(OC2CCOC2)c1)C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c1-8(13(17)18)15-12(16)9-2-4-14-11(6-9)20-10-3-5-19-7-10/h2,4,6,8,10H,3,5,7H2,1H3,(H,15,16)(H,17,18)/t8-,10?/m0/s1 |
| InChIKey | QLPMRGWGHDZWFA-PEHGTWAWSA-N |
| XLogP | 0.45 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |