C28H22F3N3O3S — CID 67038625
2-[1-(4-methylphenyl)sulfonyl-7-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]-N-quinolin-7-ylacetamide (PubChem CID 67038625) has the molecular formula C28H22F3N3O3S and a molecular weight of 537.56 g/mol. Its IUPAC name is 2-[1-(4-methylphenyl)sulfonyl-7-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]-N-quinolin-7-ylacetamide.
| Compound Name | 2-[1-(4-methylphenyl)sulfonyl-7-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]-N-quinolin-7-ylacetamide |
|---|---|
| PubChem CID | 67038625 |
| Molecular Formula | C28H22F3N3O3S |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 2-[1-(4-methylphenyl)sulfonyl-7-(trifluoromethyl)-2,3-dihydroquinolin-4-ylidene]-N-quinolin-7-ylacetamide |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(=CC(=O)Nc3ccc4cccnc4c3)c3ccc(C(F)(F)F)cc32)cc1 |
| InChI | InChI=1S/C28H22F3N3O3S/c1-18-4-9-23(10-5-18)38(36,37)34-14-12-20(24-11-7-21(16-26(24)34)28(29,30)31)15-27(35)33-22-8-6-19-3-2-13-32-25(19)17-22/h2-11,13,15-17H,12,14H2,1H3,(H,33,35) |
| InChIKey | YQEDAVWOKBSEFT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|