C20H26ClF3N2O3 — CID 18456191
(E)-1-(4-pentan-3-ylpiperazin-1-yl)-4-[4-(trifluoromethoxy)phenyl]but-2-ene-1,4-dione;hydrochloride (PubChem CID 18456191) has the molecular formula C20H26ClF3N2O3 and a molecular weight of 434.89 g/mol. Its IUPAC name is (E)-1-(4-pentan-3-ylpiperazin-1-yl)-4-[4-(trifluoromethoxy)phenyl]but-2-ene-1,4-dione;hydrochloride.
| Compound Name | (E)-1-(4-pentan-3-ylpiperazin-1-yl)-4-[4-(trifluoromethoxy)phenyl]but-2-ene-1,4-dione;hydrochloride |
|---|---|
| PubChem CID | 18456191 |
| Molecular Formula | C20H26ClF3N2O3 |
| Molecular Weight | 434.89 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-1-(4-pentan-3-ylpiperazin-1-yl)-4-[4-(trifluoromethoxy)phenyl]but-2-ene-1,4-dione;hydrochloride |
| SMILES | CCC(CC)N1CCN(C(=O)/C=C/C(=O)c2ccc(OC(F)(F)F)cc2)CC1.Cl |
| InChI | InChI=1S/C20H25F3N2O3.ClH/c1-3-16(4-2)24-11-13-25(14-12-24)19(27)10-9-18(26)15-5-7-17(8-6-15)28-20(21,22)23;/h5-10,16H,3-4,11-14H2,1-2H3;1H/b10-9+; |
| InChIKey | IZYTXNCHWUFSIG-RRABGKBLSA-N |
| XLogP | 4.08 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.89 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|