C19H24Cl2N2O2 — CID 73446604
1-(3,4-dichlorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)but-2-ene-1,4-dione (PubChem CID 73446604) has the molecular formula C19H24Cl2N2O2 and a molecular weight of 383.32 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)but-2-ene-1,4-dione.
| Compound Name | 1-(3,4-dichlorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)but-2-ene-1,4-dione |
|---|---|
| PubChem CID | 73446604 |
| Molecular Formula | C19H24Cl2N2O2 |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-4-(4-pentan-3-ylpiperazin-1-yl)but-2-ene-1,4-dione |
| SMILES | CCC(CC)N1CCN(C(=O)C=CC(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H24Cl2N2O2/c1-3-15(4-2)22-9-11-23(12-10-22)19(25)8-7-18(24)14-5-6-16(20)17(21)13-14/h5-8,13,15H,3-4,9-12H2,1-2H3 |
| InChIKey | DMTIMLCVVIMBEC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|