C19H26Cl2N2O — CID 69021126
4-(3,4-dichlorophenyl)-1-(4-pentan-3-ylpiperazin-1-yl)but-2-en-1-one (PubChem CID 69021126) has the molecular formula C19H26Cl2N2O and a molecular weight of 369.34 g/mol. Its IUPAC name is 4-(3,4-dichlorophenyl)-1-(4-pentan-3-ylpiperazin-1-yl)but-2-en-1-one.
| Compound Name | 4-(3,4-dichlorophenyl)-1-(4-pentan-3-ylpiperazin-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 69021126 |
| Molecular Formula | C19H26Cl2N2O |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 4-(3,4-dichlorophenyl)-1-(4-pentan-3-ylpiperazin-1-yl)but-2-en-1-one |
| SMILES | CCC(CC)N1CCN(C(=O)C=CCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H26Cl2N2O/c1-3-16(4-2)22-10-12-23(13-11-22)19(24)7-5-6-15-8-9-17(20)18(21)14-15/h5,7-9,14,16H,3-4,6,10-13H2,1-2H3 |
| InChIKey | IOADEHRYWNDBLD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|