C15H18Cl2N2O2 — CID 134061564
1-(4-acetyl-1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)ethanone (PubChem CID 134061564) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)ethanone.
| Compound Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)ethanone |
|---|---|
| PubChem CID | 134061564 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 1-(4-acetyl-1,4-diazepan-1-yl)-2-(3,4-dichlorophenyl)ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-11(20)18-5-2-6-19(8-7-18)15(21)10-12-3-4-13(16)14(17)9-12/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | ROAOYWGITQWERY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |