C19H25F3N2O2 — CID 91285853
3-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one (PubChem CID 91285853) has the molecular formula C19H25F3N2O2 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 91285853 |
| Molecular Formula | C19H25F3N2O2 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-[(2S)-2-(diethylaminomethyl)pyrrolidin-1-yl]-1-[4-(trifluoromethoxy)phenyl]prop-2-en-1-one |
| SMILES | CCN(CC)C[C@@H]1CCCN1C=CC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C19H25F3N2O2/c1-3-23(4-2)14-16-6-5-12-24(16)13-11-18(25)15-7-9-17(10-8-15)26-19(20,21)22/h7-11,13,16H,3-6,12,14H2,1-2H3/t16-/m0/s1 |
| InChIKey | HUDTXHAXWTVIIM-INIZCTEOSA-N |
| XLogP | 4.09 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|