C26H39N3O2S — CID 46024160
2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-1-thiomorpholin-4-ylethanone (PubChem CID 46024160) has the molecular formula C26H39N3O2S and a molecular weight of 457.68 g/mol. Its IUPAC name is 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-1-thiomorpholin-4-ylethanone.
| Compound Name | 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-1-thiomorpholin-4-ylethanone |
|---|---|
| PubChem CID | 46024160 |
| Molecular Formula | C26H39N3O2S |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-1-thiomorpholin-4-ylethanone |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCN(C(C(=O)N3CCSCC3)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C26H39N3O2S/c1-26(2,3)22-10-8-21(9-11-22)24(30)28-14-12-27(13-15-28)23(20-6-4-5-7-20)25(31)29-16-18-32-19-17-29/h8-11,20,23H,4-7,12-19H2,1-3H3 |
| InChIKey | QDCHAIFIDNPORW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |