C29H39N3O2 — CID 93221756
(2S)-2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(3-methylphenyl)acetamide (PubChem CID 93221756) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is (2S)-2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(3-methylphenyl)acetamide.
| Compound Name | (2S)-2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 93221756 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | (2S)-2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(3-methylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)[C@H](C2CCCC2)N2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)c1 |
| InChI | InChI=1S/C29H39N3O2/c1-21-8-7-11-25(20-21)30-27(33)26(22-9-5-6-10-22)31-16-18-32(19-17-31)28(34)23-12-14-24(15-13-23)29(2,3)4/h7-8,11-15,20,22,26H,5-6,9-10,16-19H2,1-4H3,(H,30,33)/t26-/m0/s1 |
| InChIKey | VFVORJFGIGDSPN-SANMLTNESA-N |
| XLogP | 5.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |