C27H41N3O3 — CID 46024452
2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 46024452) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 46024452 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 2-[4-(4-tert-butylbenzoyl)piperazin-1-yl]-2-cyclopentyl-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCN(C(C(=O)NCC3CCCO3)C3CCCC3)CC2)cc1 |
| InChI | InChI=1S/C27H41N3O3/c1-27(2,3)22-12-10-21(11-13-22)26(32)30-16-14-29(15-17-30)24(20-7-4-5-8-20)25(31)28-19-23-9-6-18-33-23/h10-13,20,23-24H,4-9,14-19H2,1-3H3,(H,28,31) |
| InChIKey | VLYJEABCONJYGH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |