C21H22F3N3O2S — CID 56552548
N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56552548) has the molecular formula C21H22F3N3O2S and a molecular weight of 437.49 g/mol. Its IUPAC name is N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56552548 |
| Molecular Formula | C21H22F3N3O2S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | N-[4-(2-oxo-2-thiomorpholin-4-ylethyl)phenyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)Nc1ccc(CC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C21H22F3N3O2S/c22-21(23,24)16-2-1-3-18(13-16)25-14-19(28)26-17-6-4-15(5-7-17)12-20(29)27-8-10-30-11-9-27/h1-7,13,25H,8-12,14H2,(H,26,28) |
| InChIKey | XHDYKDFIRAATGO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |