C24H24F3NO3S — CID 173398206
3-(3,4-dimethoxyphenyl)-1-thiomorpholin-4-yl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one (PubChem CID 173398206) has the molecular formula C24H24F3NO3S and a molecular weight of 463.52 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-thiomorpholin-4-yl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-thiomorpholin-4-yl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
|---|---|
| PubChem CID | 173398206 |
| Molecular Formula | C24H24F3NO3S |
| Molecular Weight | 463.52 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-thiomorpholin-4-yl-5-[3-(trifluoromethyl)phenyl]penta-2,4-dien-1-one |
| SMILES | COc1ccc(C(C=Cc2cccc(C(F)(F)F)c2)=CC(=O)N2CCSCC2)cc1OC |
| InChI | InChI=1S/C24H24F3NO3S/c1-30-21-9-8-18(15-22(21)31-2)19(16-23(29)28-10-12-32-13-11-28)7-6-17-4-3-5-20(14-17)24(25,26)27/h3-9,14-16H,10-13H2,1-2H3 |
| InChIKey | QQDZYUHCHOHZKH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.52 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|