C17H19BrClNS — CID 114864301
N-[[2-(2-bromophenyl)sulfanyl-4-chlorophenyl]methyl]-2-methylpropan-1-amine (PubChem CID 114864301) has the molecular formula C17H19BrClNS and a molecular weight of 384.77 g/mol. Its IUPAC name is N-[[2-(2-bromophenyl)sulfanyl-4-chlorophenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[2-(2-bromophenyl)sulfanyl-4-chlorophenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114864301 |
| Molecular Formula | C17H19BrClNS |
| Molecular Weight | 384.77 g/mol |
| Exact Mass | 383.01 |
| IUPAC Name | N-[[2-(2-bromophenyl)sulfanyl-4-chlorophenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1ccc(Cl)cc1Sc1ccccc1Br |
| InChI | InChI=1S/C17H19BrClNS/c1-12(2)10-20-11-13-7-8-14(19)9-17(13)21-16-6-4-3-5-15(16)18/h3-9,12,20H,10-11H2,1-2H3 |
| InChIKey | BSJZQJPXBQUXSD-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.77 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |