C12H18ClNO2S — CID 113317875
1-(3-chlorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol (PubChem CID 113317875) has the molecular formula C12H18ClNO2S and a molecular weight of 275.80 g/mol. Its IUPAC name is 1-(3-chlorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol.
| Compound Name | 1-(3-chlorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol |
|---|---|
| PubChem CID | 113317875 |
| Molecular Formula | C12H18ClNO2S |
| Molecular Weight | 275.80 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(3-chlorophenyl)sulfanyl-3-(2-methoxyethylamino)propan-2-ol |
| SMILES | COCCNCC(O)CSc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO2S/c1-16-6-5-14-8-11(15)9-17-12-4-2-3-10(13)7-12/h2-4,7,11,14-15H,5-6,8-9H2,1H3 |
| InChIKey | QUTIYXWBMGCEKS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|