C15H24ClNOS — CID 107761609
N-[[3-chloro-4-(3-methylbutan-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine (PubChem CID 107761609) has the molecular formula C15H24ClNOS and a molecular weight of 301.88 g/mol. Its IUPAC name is N-[[3-chloro-4-(3-methylbutan-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[3-chloro-4-(3-methylbutan-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 107761609 |
| Molecular Formula | C15H24ClNOS |
| Molecular Weight | 301.88 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-[[3-chloro-4-(3-methylbutan-2-ylsulfanyl)phenyl]methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1ccc(SC(C)C(C)C)c(Cl)c1 |
| InChI | InChI=1S/C15H24ClNOS/c1-11(2)12(3)19-15-6-5-13(9-14(15)16)10-17-7-8-18-4/h5-6,9,11-12,17H,7-8,10H2,1-4H3 |
| InChIKey | JXEBUHOUMLPPSZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|