C14H21F2NOS — CID 63806055
N-[(4-butan-2-ylsulfanyl-3,5-difluorophenyl)methyl]-2-methoxyethanamine (PubChem CID 63806055) has the molecular formula C14H21F2NOS and a molecular weight of 289.39 g/mol. Its IUPAC name is N-[(4-butan-2-ylsulfanyl-3,5-difluorophenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(4-butan-2-ylsulfanyl-3,5-difluorophenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 63806055 |
| Molecular Formula | C14H21F2NOS |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[(4-butan-2-ylsulfanyl-3,5-difluorophenyl)methyl]-2-methoxyethanamine |
| SMILES | CCC(C)Sc1c(F)cc(CNCCOC)cc1F |
| InChI | InChI=1S/C14H21F2NOS/c1-4-10(2)19-14-12(15)7-11(8-13(14)16)9-17-5-6-18-3/h7-8,10,17H,4-6,9H2,1-3H3 |
| InChIKey | VEEVVCZYVIVGJC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|