C14H22N2O5 — CID 106236435
2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]acetamide (PubChem CID 106236435) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106236435 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | 2-[2-[(3,4,5-trimethoxyphenyl)methylamino]ethoxy]acetamide |
| SMILES | COc1cc(CNCCOCC(N)=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H22N2O5/c1-18-11-6-10(7-12(19-2)14(11)20-3)8-16-4-5-21-9-13(15)17/h6-7,16H,4-5,8-9H2,1-3H3,(H2,15,17) |
| InChIKey | XVSBSTLYUQPWDU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|