C18H18ClF2NO3S — CID 142633124
ethyl 2-[4-[2-(4-chloroanilino)ethylsulfanyl]-2,6-difluorophenoxy]acetate (PubChem CID 142633124) has the molecular formula C18H18ClF2NO3S and a molecular weight of 401.86 g/mol. Its IUPAC name is ethyl 2-[4-[2-(4-chloroanilino)ethylsulfanyl]-2,6-difluorophenoxy]acetate.
| Compound Name | ethyl 2-[4-[2-(4-chloroanilino)ethylsulfanyl]-2,6-difluorophenoxy]acetate |
|---|---|
| PubChem CID | 142633124 |
| Molecular Formula | C18H18ClF2NO3S |
| Molecular Weight | 401.86 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | ethyl 2-[4-[2-(4-chloroanilino)ethylsulfanyl]-2,6-difluorophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(F)cc(SCCNc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C18H18ClF2NO3S/c1-2-24-17(23)11-25-18-15(20)9-14(10-16(18)21)26-8-7-22-13-5-3-12(19)4-6-13/h3-6,9-10,22H,2,7-8,11H2,1H3 |
| InChIKey | RXNAVNBAOCWIFV-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.86 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|