C16H14ClN3O4S2 — CID 31078383
N-[2-(4-chlorophenyl)sulfanylethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide (PubChem CID 31078383) has the molecular formula C16H14ClN3O4S2 and a molecular weight of 411.89 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)sulfanylethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide.
| Compound Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
|---|---|
| PubChem CID | 31078383 |
| Molecular Formula | C16H14ClN3O4S2 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | N-[2-(4-chlorophenyl)sulfanylethyl]-2,3-dioxo-1,4-dihydroquinoxaline-6-sulfonamide |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)NCCSc3ccc(Cl)cc3)cc2[nH]c1=O |
| InChI | InChI=1S/C16H14ClN3O4S2/c17-10-1-3-11(4-2-10)25-8-7-18-26(23,24)12-5-6-13-14(9-12)20-16(22)15(21)19-13/h1-6,9,18H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | PLGVCQDLNMDPTQ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|