C17H20F2N2O3S — CID 29425150
N'-(2,6-difluorophenyl)sulfonyladamantane-1-carbohydrazide (PubChem CID 29425150) has the molecular formula C17H20F2N2O3S and a molecular weight of 370.42 g/mol. Its IUPAC name is N'-(2,6-difluorophenyl)sulfonyladamantane-1-carbohydrazide.
| Compound Name | N'-(2,6-difluorophenyl)sulfonyladamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 29425150 |
| Molecular Formula | C17H20F2N2O3S |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N'-(2,6-difluorophenyl)sulfonyladamantane-1-carbohydrazide |
| SMILES | O=C(NNS(=O)(=O)c1c(F)cccc1F)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H20F2N2O3S/c18-13-2-1-3-14(19)15(13)25(23,24)21-20-16(22)17-7-10-4-11(8-17)6-12(5-10)9-17/h1-3,10-12,21H,4-9H2,(H,20,22) |
| InChIKey | BEELVSWMTBMPSM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|