C12H15N3O3S — CID 102691931
N-[1-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide (PubChem CID 102691931) has the molecular formula C12H15N3O3S and a molecular weight of 281.34 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide.
| Compound Name | N-[1-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102691931 |
| Molecular Formula | C12H15N3O3S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[1-(3-methoxyphenyl)ethyl]-1H-pyrazole-5-sulfonamide |
| SMILES | COc1cccc(C(C)NS(=O)(=O)c2ccn[nH]2)c1 |
| InChI | InChI=1S/C12H15N3O3S/c1-9(10-4-3-5-11(8-10)18-2)15-19(16,17)12-6-7-13-14-12/h3-9,15H,1-2H3,(H,13,14) |
| InChIKey | IJEZDPJJCBKBSQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |