C8H13N3O4S — CID 102690644
3-methyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid (PubChem CID 102690644) has the molecular formula C8H13N3O4S and a molecular weight of 247.28 g/mol. Its IUPAC name is 3-methyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid.
| Compound Name | 3-methyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 102690644 |
| Molecular Formula | C8H13N3O4S |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-methyl-2-(1H-pyrazol-5-ylsulfonylamino)butanoic acid |
| SMILES | CC(C)C(NS(=O)(=O)c1ccn[nH]1)C(=O)O |
| InChI | InChI=1S/C8H13N3O4S/c1-5(2)7(8(12)13)11-16(14,15)6-3-4-9-10-6/h3-5,7,11H,1-2H3,(H,9,10)(H,12,13) |
| InChIKey | VMRYLMYTTPLSKZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |