C9H17N3O3S — CID 106352662
N-(1-hydroxy-4-methylpentan-3-yl)-1H-pyrazole-5-sulfonamide (PubChem CID 106352662) has the molecular formula C9H17N3O3S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-3-yl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-3-yl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106352662 |
| Molecular Formula | C9H17N3O3S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-3-yl)-1H-pyrazole-5-sulfonamide |
| SMILES | CC(C)C(CCO)NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C9H17N3O3S/c1-7(2)8(4-6-13)12-16(14,15)9-3-5-10-11-9/h3,5,7-8,12-13H,4,6H2,1-2H3,(H,10,11) |
| InChIKey | ZKRFMDSRQKTMIZ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 95.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |