C10H19N3O3S — CID 104773051
N-(1-hydroxy-4-methylpentan-3-yl)-2-methylpyrazole-3-sulfonamide (PubChem CID 104773051) has the molecular formula C10H19N3O3S and a molecular weight of 261.35 g/mol. Its IUPAC name is N-(1-hydroxy-4-methylpentan-3-yl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(1-hydroxy-4-methylpentan-3-yl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104773051 |
| Molecular Formula | C10H19N3O3S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(1-hydroxy-4-methylpentan-3-yl)-2-methylpyrazole-3-sulfonamide |
| SMILES | CC(C)C(CCO)NS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C10H19N3O3S/c1-8(2)9(5-7-14)12-17(15,16)10-4-6-11-13(10)3/h4,6,8-9,12,14H,5,7H2,1-3H3 |
| InChIKey | OSMGGZZGPFICOW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |