C9H15N3O4S — CID 104709744
3-[(2-methylpyrazol-3-yl)sulfonylamino]pentanoic acid (PubChem CID 104709744) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-[(2-methylpyrazol-3-yl)sulfonylamino]pentanoic acid.
| Compound Name | 3-[(2-methylpyrazol-3-yl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 104709744 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 3-[(2-methylpyrazol-3-yl)sulfonylamino]pentanoic acid |
| SMILES | CCC(CC(=O)O)NS(=O)(=O)c1ccnn1C |
| InChI | InChI=1S/C9H15N3O4S/c1-3-7(6-9(13)14)11-17(15,16)8-4-5-10-12(8)2/h4-5,7,11H,3,6H2,1-2H3,(H,13,14) |
| InChIKey | HIWARSANXOEETN-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |