C14H22N2O4S — CID 15929428
(2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutane-1-sulfonic acid (PubChem CID 15929428) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutane-1-sulfonic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutane-1-sulfonic acid |
|---|---|
| PubChem CID | 15929428 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-3-methylbutane-1-sulfonic acid |
| SMILES | CC(C)[C@@H](CS(=O)(=O)O)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C14H22N2O4S/c1-10(2)13(9-21(18,19)20)16-14(17)12(15)8-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,15H2,1-2H3,(H,16,17)(H,18,19,20)/t12-,13+/m0/s1 |
| InChIKey | JACZJZVVHJVWDU-QWHCGFSZSA-N |
| XLogP | 0.58 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|