C11H11F2NO6S — CID 142765802
2-[[2-(2,4-difluorophenyl)acetyl]amino]-3-sulfopropanoic acid (PubChem CID 142765802) has the molecular formula C11H11F2NO6S and a molecular weight of 323.27 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenyl)acetyl]amino]-3-sulfopropanoic acid.
| Compound Name | 2-[[2-(2,4-difluorophenyl)acetyl]amino]-3-sulfopropanoic acid |
|---|---|
| PubChem CID | 142765802 |
| Molecular Formula | C11H11F2NO6S |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-[[2-(2,4-difluorophenyl)acetyl]amino]-3-sulfopropanoic acid |
| SMILES | O=C(Cc1ccc(F)cc1F)NC(CS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C11H11F2NO6S/c12-7-2-1-6(8(13)4-7)3-10(15)14-9(11(16)17)5-21(18,19)20/h1-2,4,9H,3,5H2,(H,14,15)(H,16,17)(H,18,19,20) |
| InChIKey | IHHGNEJAALIZQW-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|