C18H26ClNO3S — CID 110191746
hexyl (2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 110191746) has the molecular formula C18H26ClNO3S and a molecular weight of 371.93 g/mol. Its IUPAC name is hexyl (2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | hexyl (2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 110191746 |
| Molecular Formula | C18H26ClNO3S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | hexyl (2S)-2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCCCOC(=O)[C@H](CCSC)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H26ClNO3S/c1-3-4-5-8-12-23-18(22)16(11-13-24-2)20-17(21)14-9-6-7-10-15(14)19/h6-7,9-10,16H,3-5,8,11-13H2,1-2H3,(H,20,21)/t16-/m0/s1 |
| InChIKey | SXOZNTHEQXBOSW-INIZCTEOSA-N |
| XLogP | 4.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|