C20H22ClNO3S — CID 55335128
2-phenylethyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 55335128) has the molecular formula C20H22ClNO3S and a molecular weight of 391.92 g/mol. Its IUPAC name is 2-phenylethyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | 2-phenylethyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 55335128 |
| Molecular Formula | C20H22ClNO3S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-phenylethyl 2-[(2-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=O)c1ccccc1Cl)C(=O)OCCc1ccccc1 |
| InChI | InChI=1S/C20H22ClNO3S/c1-26-14-12-18(22-19(23)16-9-5-6-10-17(16)21)20(24)25-13-11-15-7-3-2-4-8-15/h2-10,18H,11-14H2,1H3,(H,22,23) |
| InChIKey | XRLTYDVQWZABSE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |