C17H23BrN2O4S — CID 29206363
2-bromo-N-[(2R)-1-(cyclopentylamino)-4-methylsulfonyl-1-oxobutan-2-yl]benzamide (PubChem CID 29206363) has the molecular formula C17H23BrN2O4S and a molecular weight of 431.35 g/mol. Its IUPAC name is 2-bromo-N-[(2R)-1-(cyclopentylamino)-4-methylsulfonyl-1-oxobutan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[(2R)-1-(cyclopentylamino)-4-methylsulfonyl-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 29206363 |
| Molecular Formula | C17H23BrN2O4S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 430.06 |
| IUPAC Name | 2-bromo-N-[(2R)-1-(cyclopentylamino)-4-methylsulfonyl-1-oxobutan-2-yl]benzamide |
| SMILES | CS(=O)(=O)CC[C@@H](NC(=O)c1ccccc1Br)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C17H23BrN2O4S/c1-25(23,24)11-10-15(17(22)19-12-6-2-3-7-12)20-16(21)13-8-4-5-9-14(13)18/h4-5,8-9,12,15H,2-3,6-7,10-11H2,1H3,(H,19,22)(H,20,21)/t15-/m1/s1 |
| InChIKey | BTYVMDNJQJWIDM-OAHLLOKOSA-N |
| XLogP | 2.04 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |