C19H19BrN2O7S — CID 43056517
(2-nitrophenyl)methyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate (PubChem CID 43056517) has the molecular formula C19H19BrN2O7S and a molecular weight of 499.34 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate.
| Compound Name | (2-nitrophenyl)methyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
|---|---|
| PubChem CID | 43056517 |
| Molecular Formula | C19H19BrN2O7S |
| Molecular Weight | 499.34 g/mol |
| Exact Mass | 498.01 |
| IUPAC Name | (2-nitrophenyl)methyl 2-[(2-bromobenzoyl)amino]-4-methylsulfonylbutanoate |
| SMILES | CS(=O)(=O)CCC(NC(=O)c1ccccc1Br)C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19BrN2O7S/c1-30(27,28)11-10-16(21-18(23)14-7-3-4-8-15(14)20)19(24)29-12-13-6-2-5-9-17(13)22(25)26/h2-9,16H,10-12H2,1H3,(H,21,23) |
| InChIKey | WAVUGSUMDOLUEZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.34 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|