About (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate
(2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 7849226) has the molecular formula C16H15NO6S
and a molecular weight of 349.36 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate.
Molecular Properties
| Compound Name | (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate |
| PubChem CID | 7849226 |
| Molecular Formula | C16H15NO6S |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15NO6S/c1-11-7-8-13(24(2,21)22)9-14(11)16(18)23-10-12-5-3-4-6-15(12)17(19)20/h3-9H,10H2,1-2H3 |
| InChIKey | SOCJDIFKQCGVHS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate?
The IUPAC name of (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate (CID 7849226) is (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate.
What is the SMILES notation for (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate?
The canonical SMILES for (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate is Cc1ccc(S(C)(=O)=O)cc1C(=O)OCc1ccccc1[N+](=O)[O-].
What is the InChIKey of (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate?
The InChIKey is SOCJDIFKQCGVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO6S/c1-11-7-8-13(24(2,21)22)9-14(11)16(18)23-10-12-5-3-4-6-15(12)17(19)20/h3-9H,10H2,1-2H3.
What are the key properties of (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate?
(2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate has a molecular weight of 349.36 g/mol, XLogP of 2.66, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-nitrophenyl)methyl 2-methyl-5-methylsulfonylbenzoate is sourced from PubChem (CID 7849226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).