C19H17NO5S — CID 37135590
(3-phenyl-1,2-oxazol-5-yl)methyl 2-methyl-5-methylsulfonylbenzoate (PubChem CID 37135590) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is (3-phenyl-1,2-oxazol-5-yl)methyl 2-methyl-5-methylsulfonylbenzoate.
| Compound Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-methyl-5-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 37135590 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (3-phenyl-1,2-oxazol-5-yl)methyl 2-methyl-5-methylsulfonylbenzoate |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1C(=O)OCc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C19H17NO5S/c1-13-8-9-16(26(2,22)23)11-17(13)19(21)24-12-15-10-18(20-25-15)14-6-4-3-5-7-14/h3-11H,12H2,1-2H3 |
| InChIKey | MJWUKAXGTQSUKN-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 86.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |