C31H32F2O9S3 — CID 157205860
2-[[5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoyl]sulfanylmethyl]-4-oxopentanoic acid (PubChem CID 157205860) has the molecular formula C31H32F2O9S3 and a molecular weight of 682.79 g/mol. Its IUPAC name is 2-[[5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoyl]sulfanylmethyl]-4-oxopentanoic acid.
| Compound Name | 2-[[5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoyl]sulfanylmethyl]-4-oxopentanoic acid |
|---|---|
| PubChem CID | 157205860 |
| Molecular Formula | C31H32F2O9S3 |
| Molecular Weight | 682.79 g/mol |
| Exact Mass | 682.12 |
| IUPAC Name | 2-[[5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoyl]sulfanylmethyl]-4-oxopentanoic acid |
| SMILES | CC(=O)CC(CSC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)C(CSC(=O)C(CS)CC(C)=O)CC(C)=O)C(=O)O |
| InChI | InChI=1S/C31H32F2O9S3/c1-16(34)8-20(13-43)30(40)44-15-22(10-18(3)36)29(39)42-27-7-4-19(24-6-5-23(32)12-26(24)33)11-25(27)31(41)45-14-21(28(37)38)9-17(2)35/h4-7,11-12,20-22,43H,8-10,13-15H2,1-3H3,(H,37,38) |
| InChIKey | IVGLSKWKIMHPQM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 148.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.79 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|