C31H39NO10S4 — CID 157124308
[2-[2-(2-carbamoyl-4-oxopentyl)sulfanylcarbonyl-4-oxopentyl]sulfanylcarbonylphenyl] 4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoate (PubChem CID 157124308) has the molecular formula C31H39NO10S4 and a molecular weight of 713.92 g/mol. Its IUPAC name is [2-[2-(2-carbamoyl-4-oxopentyl)sulfanylcarbonyl-4-oxopentyl]sulfanylcarbonylphenyl] 4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoate.
| Compound Name | [2-[2-(2-carbamoyl-4-oxopentyl)sulfanylcarbonyl-4-oxopentyl]sulfanylcarbonylphenyl] 4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoate |
|---|---|
| PubChem CID | 157124308 |
| Molecular Formula | C31H39NO10S4 |
| Molecular Weight | 713.92 g/mol |
| Exact Mass | 713.15 |
| IUPAC Name | [2-[2-(2-carbamoyl-4-oxopentyl)sulfanylcarbonyl-4-oxopentyl]sulfanylcarbonylphenyl] 4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoate |
| SMILES | CC(=O)CC(CSC(=O)C(CSC(=O)c1ccccc1OC(=O)C(CSC(=O)C(CS)CC(C)=O)CC(C)=O)CC(C)=O)C(N)=O |
| InChI | InChI=1S/C31H39NO10S4/c1-17(33)9-21(13-43)29(39)45-15-23(11-19(3)35)28(38)42-26-8-6-5-7-25(26)31(41)46-16-24(12-20(4)36)30(40)44-14-22(27(32)37)10-18(2)34/h5-8,21-24,43H,9-16H2,1-4H3,(H2,32,37) |
| InChIKey | GRXZRAVJVSQVLK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 188.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.92 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|