C18H22N2O6S2 — CID 89132946
[2-(2-acetamido-3-oxobutyl)sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate (PubChem CID 89132946) has the molecular formula C18H22N2O6S2 and a molecular weight of 426.52 g/mol. Its IUPAC name is [2-(2-acetamido-3-oxobutyl)sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate.
| Compound Name | [2-(2-acetamido-3-oxobutyl)sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 89132946 |
| Molecular Formula | C18H22N2O6S2 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | [2-(2-acetamido-3-oxobutyl)sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)NC(CSC(=O)c1ccccc1OC(=O)C(CS)NC(C)=O)C(C)=O |
| InChI | InChI=1S/C18H22N2O6S2/c1-10(21)15(20-12(3)23)9-28-18(25)13-6-4-5-7-16(13)26-17(24)14(8-27)19-11(2)22/h4-7,14-15,27H,8-9H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | FQUDMLAOSWFLNP-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|