C15H17NO5S — CID 91046266
(2-acetylphenyl) (2-acetamido-3-oxobutyl)sulfanylformate (PubChem CID 91046266) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is (2-acetylphenyl) (2-acetamido-3-oxobutyl)sulfanylformate.
| Compound Name | (2-acetylphenyl) (2-acetamido-3-oxobutyl)sulfanylformate |
|---|---|
| PubChem CID | 91046266 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (2-acetylphenyl) (2-acetamido-3-oxobutyl)sulfanylformate |
| SMILES | CC(=O)NC(CSC(=O)Oc1ccccc1C(C)=O)C(C)=O |
| InChI | InChI=1S/C15H17NO5S/c1-9(17)12-6-4-5-7-14(12)21-15(20)22-8-13(10(2)18)16-11(3)19/h4-7,13H,8H2,1-3H3,(H,16,19) |
| InChIKey | ZRZANSCHZAQSNC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|