C17H23NO6S — CID 123155824
tert-butyl 2-(2-acetamido-3-hydroxypropyl)sulfanylcarbonyloxybenzoate (PubChem CID 123155824) has the molecular formula C17H23NO6S and a molecular weight of 369.44 g/mol. Its IUPAC name is tert-butyl 2-(2-acetamido-3-hydroxypropyl)sulfanylcarbonyloxybenzoate.
| Compound Name | tert-butyl 2-(2-acetamido-3-hydroxypropyl)sulfanylcarbonyloxybenzoate |
|---|---|
| PubChem CID | 123155824 |
| Molecular Formula | C17H23NO6S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | tert-butyl 2-(2-acetamido-3-hydroxypropyl)sulfanylcarbonyloxybenzoate |
| SMILES | CC(=O)NC(CO)CSC(=O)Oc1ccccc1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H23NO6S/c1-11(20)18-12(9-19)10-25-16(22)23-14-8-6-5-7-13(14)15(21)24-17(2,3)4/h5-8,12,19H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | JRSPCMXDFSDRRX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|