C24H27F2NO6S — CID 123764010
[4-(2,4-difluorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]phenyl] (2-acetamido-3-hydroxypropyl)sulfanylformate (PubChem CID 123764010) has the molecular formula C24H27F2NO6S and a molecular weight of 495.54 g/mol. Its IUPAC name is [4-(2,4-difluorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]phenyl] (2-acetamido-3-hydroxypropyl)sulfanylformate.
| Compound Name | [4-(2,4-difluorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]phenyl] (2-acetamido-3-hydroxypropyl)sulfanylformate |
|---|---|
| PubChem CID | 123764010 |
| Molecular Formula | C24H27F2NO6S |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | [4-(2,4-difluorophenyl)-2-[2-[(2-methylpropan-2-yl)oxy]oxiran-2-yl]phenyl] (2-acetamido-3-hydroxypropyl)sulfanylformate |
| SMILES | CC(=O)NC(CO)CSC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C1(OC(C)(C)C)CO1 |
| InChI | InChI=1S/C24H27F2NO6S/c1-14(29)27-17(11-28)12-34-22(30)32-21-8-5-15(18-7-6-16(25)10-20(18)26)9-19(21)24(13-31-24)33-23(2,3)4/h5-10,17,28H,11-13H2,1-4H3,(H,27,29) |
| InChIKey | RWTCXBWTPSELHV-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|