About 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid
2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid (PubChem CID 76518308) has the molecular formula C20H17F2NO7S
and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid.
Molecular Properties
| Compound Name | 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid |
| PubChem CID | 76518308 |
| Molecular Formula | C20H17F2NO7S |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid |
| SMILES | COC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)SCC(NC(C)=O)C(=O)O |
| InChI | InChI=1S/C20H17F2NO7S/c1-10(24)23-16(18(25)26)9-31-20(28)30-17-6-3-11(7-14(17)19(27)29-2)13-5-4-12(21)8-15(13)22/h3-8,16H,9H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | MXMSQKXTLVPGJR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid?
The IUPAC name of 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid (CID 76518308) is 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid.
What is the SMILES notation for 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid?
The canonical SMILES for 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid is COC(=O)c1cc(-c2ccc(F)cc2F)ccc1OC(=O)SCC(NC(C)=O)C(=O)O.
What is the InChIKey of 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid?
The InChIKey is MXMSQKXTLVPGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17F2NO7S/c1-10(24)23-16(18(25)26)9-31-20(28)30-17-6-3-11(7-14(17)19(27)29-2)13-5-4-12(21)8-15(13)22/h3-8,16H,9H2,1-2H3,(H,23,24)(H,25,26).
What are the key properties of 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid?
2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid has a molecular weight of 453.42 g/mol, XLogP of 3.24, 7 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-3-[4-(2,4-difluorophenyl)-2-methoxycarbonylphenoxy]carbonylsulfanylpropanoic acid is sourced from PubChem (CID 76518308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).