C22H21F2NO7S — CID 59487661
methyl 2-[(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate (PubChem CID 59487661) has the molecular formula C22H21F2NO7S and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl 2-[(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate.
| Compound Name | methyl 2-[(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate |
|---|---|
| PubChem CID | 59487661 |
| Molecular Formula | C22H21F2NO7S |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.10 |
| IUPAC Name | methyl 2-[(2R)-2-acetamido-3-ethoxy-3-oxopropyl]sulfanylcarbonyloxy-5-(2,4-difluorophenyl)benzoate |
| SMILES | CCOC(=O)[C@H](CSC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)OC)NC(C)=O |
| InChI | InChI=1S/C22H21F2NO7S/c1-4-31-21(28)18(25-12(2)26)11-33-22(29)32-19-8-5-13(9-16(19)20(27)30-3)15-7-6-14(23)10-17(15)24/h5-10,18H,4,11H2,1-3H3,(H,25,26)/t18-/m0/s1 |
| InChIKey | PZXSSAZFMZBSAD-SFHVURJKSA-N |
| XLogP | 3.72 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|