C26H21F2NO7S — CID 57345036
(2R)-2-acetamido-3-[4-(2,4-difluorophenyl)-2-phenylmethoxycarbonylphenoxy]carbonylsulfanylpropanoic acid (PubChem CID 57345036) has the molecular formula C26H21F2NO7S and a molecular weight of 529.52 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[4-(2,4-difluorophenyl)-2-phenylmethoxycarbonylphenoxy]carbonylsulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[4-(2,4-difluorophenyl)-2-phenylmethoxycarbonylphenoxy]carbonylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 57345036 |
| Molecular Formula | C26H21F2NO7S |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | (2R)-2-acetamido-3-[4-(2,4-difluorophenyl)-2-phenylmethoxycarbonylphenoxy]carbonylsulfanylpropanoic acid |
| SMILES | CC(=O)N[C@@H](CSC(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C26H21F2NO7S/c1-15(30)29-22(24(31)32)14-37-26(34)36-23-10-7-17(19-9-8-18(27)12-21(19)28)11-20(23)25(33)35-13-16-5-3-2-4-6-16/h2-12,22H,13-14H2,1H3,(H,29,30)(H,31,32)/t22-/m0/s1 |
| InChIKey | FJUXCXJSPHKVPV-QFIPXVFZSA-N |
| XLogP | 4.81 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|