C18H24N6O6S — CID 59487589
methyl 2-[(2R)-2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonyloxybenzoate (PubChem CID 59487589) has the molecular formula C18H24N6O6S and a molecular weight of 452.49 g/mol. Its IUPAC name is methyl 2-[(2R)-2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonyloxybenzoate.
| Compound Name | methyl 2-[(2R)-2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonyloxybenzoate |
|---|---|
| PubChem CID | 59487589 |
| Molecular Formula | C18H24N6O6S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | methyl 2-[(2R)-2-acetamido-3-[[amino-[(E)-[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonyloxybenzoate |
| SMILES | COC(=O)c1ccccc1OC(=O)SC[C@H](NC(C)=O)C(=O)/N=C(N)/N=C(\N)N(C)C |
| InChI | InChI=1S/C18H24N6O6S/c1-10(25)21-12(14(26)22-16(19)23-17(20)24(2)3)9-31-18(28)30-13-8-6-5-7-11(13)15(27)29-4/h5-8,12H,9H2,1-4H3,(H,21,25)(H4,19,20,22,23,26)/t12-/m0/s1 |
| InChIKey | QAICEGWISRUIQS-LBPRGKRZSA-N |
| XLogP | -0.07 |
| TPSA | 178.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|