C21H29N7O6S2 — CID 76698671
[2-[2-acetamido-3-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate (PubChem CID 76698671) has the molecular formula C21H29N7O6S2 and a molecular weight of 539.64 g/mol. Its IUPAC name is [2-[2-acetamido-3-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate.
| Compound Name | [2-[2-acetamido-3-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 76698671 |
| Molecular Formula | C21H29N7O6S2 |
| Molecular Weight | 539.64 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [2-[2-acetamido-3-[[amino-[[amino(dimethylamino)methylidene]amino]methylidene]amino]-3-oxopropyl]sulfanylcarbonylphenyl] 2-acetamido-3-sulfanylpropanoate |
| SMILES | CC(=O)NC(CSC(=O)c1ccccc1OC(=O)C(CS)NC(C)=O)C(=O)/N=C(\N)N=C(N)N(C)C |
| InChI | InChI=1S/C21H29N7O6S2/c1-11(29)24-14(9-35)18(32)34-16-8-6-5-7-13(16)19(33)36-10-15(25-12(2)30)17(31)26-20(22)27-21(23)28(3)4/h5-8,14-15,35H,9-10H2,1-4H3,(H,24,29)(H,25,30)(H4,22,23,26,27,31) |
| InChIKey | GFXHMAFHINUHFO-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 198.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.64 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|