C28H32N2O8S2 — CID 89132948
[2-(2-acetamido-3-ethoxy-3-oxopropyl)sulfanylcarbonylphenyl] 2-[2-[[(Z)-but-2-en-2-yl]amino]-3-sulfanylpropanoyl]oxybenzoate (PubChem CID 89132948) has the molecular formula C28H32N2O8S2 and a molecular weight of 588.70 g/mol. Its IUPAC name is [2-(2-acetamido-3-ethoxy-3-oxopropyl)sulfanylcarbonylphenyl] 2-[2-[[(Z)-but-2-en-2-yl]amino]-3-sulfanylpropanoyl]oxybenzoate.
| Compound Name | [2-(2-acetamido-3-ethoxy-3-oxopropyl)sulfanylcarbonylphenyl] 2-[2-[[(Z)-but-2-en-2-yl]amino]-3-sulfanylpropanoyl]oxybenzoate |
|---|---|
| PubChem CID | 89132948 |
| Molecular Formula | C28H32N2O8S2 |
| Molecular Weight | 588.70 g/mol |
| Exact Mass | 588.16 |
| IUPAC Name | [2-(2-acetamido-3-ethoxy-3-oxopropyl)sulfanylcarbonylphenyl] 2-[2-[[(Z)-but-2-en-2-yl]amino]-3-sulfanylpropanoyl]oxybenzoate |
| SMILES | C/C=C(/C)NC(CS)C(=O)Oc1ccccc1C(=O)Oc1ccccc1C(=O)SCC(NC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C28H32N2O8S2/c1-5-17(3)29-21(15-39)27(34)38-23-13-9-7-11-19(23)25(32)37-24-14-10-8-12-20(24)28(35)40-16-22(30-18(4)31)26(33)36-6-2/h5,7-14,21-22,29,39H,6,15-16H2,1-4H3,(H,30,31)/b17-5- |
| InChIKey | INRVDMKOUMNSGM-ZWSORDCHSA-N |
| XLogP | 3.56 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.70 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|