C25H24F2O7S2 — CID 159882630
5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoic acid (PubChem CID 159882630) has the molecular formula C25H24F2O7S2 and a molecular weight of 538.59 g/mol. Its IUPAC name is 5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoic acid.
| Compound Name | 5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 159882630 |
| Molecular Formula | C25H24F2O7S2 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 5-(2,4-difluorophenyl)-2-[4-oxo-2-[[4-oxo-2-(sulfanylmethyl)pentanoyl]sulfanylmethyl]pentanoyl]oxybenzoic acid |
| SMILES | CC(=O)CC(CSC(=O)C(CS)CC(C)=O)C(=O)Oc1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C25H24F2O7S2/c1-13(28)7-16(11-35)25(33)36-12-17(8-14(2)29)24(32)34-22-6-3-15(9-20(22)23(30)31)19-5-4-18(26)10-21(19)27/h3-6,9-10,16-17,35H,7-8,11-12H2,1-2H3,(H,30,31) |
| InChIKey | BSVCSRBYITWEIZ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|