C34H30F4O6 — CID 11763391
2-[8-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]octoxy]-5-(2,4-difluorophenyl)benzoic acid (PubChem CID 11763391) has the molecular formula C34H30F4O6 and a molecular weight of 610.60 g/mol. Its IUPAC name is 2-[8-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]octoxy]-5-(2,4-difluorophenyl)benzoic acid.
| Compound Name | 2-[8-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]octoxy]-5-(2,4-difluorophenyl)benzoic acid |
|---|---|
| PubChem CID | 11763391 |
| Molecular Formula | C34H30F4O6 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.20 |
| IUPAC Name | 2-[8-[2-carboxy-4-(2,4-difluorophenyl)phenoxy]octoxy]-5-(2,4-difluorophenyl)benzoic acid |
| SMILES | O=C(O)c1cc(-c2ccc(F)cc2F)ccc1OCCCCCCCCOc1ccc(-c2ccc(F)cc2F)cc1C(=O)O |
| InChI | InChI=1S/C34H30F4O6/c35-23-9-11-25(29(37)19-23)21-7-13-31(27(17-21)33(39)40)43-15-5-3-1-2-4-6-16-44-32-14-8-22(18-28(32)34(41)42)26-12-10-24(36)20-30(26)38/h7-14,17-20H,1-6,15-16H2,(H,39,40)(H,41,42) |
| InChIKey | XTJZALJBALUHIA-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|